C20H26BrN3O3 — CID 129011359
tert-butyl 3-[4-bromo-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]pyrrolidine-1-carboxylate (PubChem CID 129011359) has the molecular formula C20H26BrN3O3 and a molecular weight of 436.35 g/mol. Its IUPAC name is tert-butyl 3-[4-bromo-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-bromo-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129011359 |
| Molecular Formula | C20H26BrN3O3 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | tert-butyl 3-[4-bromo-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(Cn2cc(Br)c(C3CCN(C(=O)OC(C)(C)C)C3)n2)cc1 |
| InChI | InChI=1S/C20H26BrN3O3/c1-20(2,3)27-19(25)23-10-9-15(12-23)18-17(21)13-24(22-18)11-14-5-7-16(26-4)8-6-14/h5-8,13,15H,9-12H2,1-4H3 |
| InChIKey | HPVYQGGXKBDBCN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |