C25H30O4 — CID 129011511
(1S,9S,10S,11S)-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione (PubChem CID 129011511) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (1S,9S,10S,11S)-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione.
| Compound Name | (1S,9S,10S,11S)-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione |
|---|---|
| PubChem CID | 129011511 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (1S,9S,10S,11S)-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H]2C(=O)c3c(O)cc(O)cc3[C@@]3(CC(=C(C)C)C[C@@H]13)C2=O |
| InChI | InChI=1S/C25H30O4/c1-13(2)7-6-8-24(5)19-9-15(14(3)4)12-25(19)17-10-16(26)11-18(27)20(17)22(28)21(24)23(25)29/h7,10-11,19,21,26-27H,6,8-9,12H2,1-5H3/t19-,21+,24-,25+/m0/s1 |
| InChIKey | QHMTWUPGGIBSFH-JNWPTLATSA-N |
| XLogP | 5.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|