C25H29ClO2 — CID 129011514
(1S,9S,10S,11R)-9-chloro-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2,4,6-triene-8,15-dione (PubChem CID 129011514) has the molecular formula C25H29ClO2 and a molecular weight of 396.96 g/mol. Its IUPAC name is (1S,9S,10S,11R)-9-chloro-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2,4,6-triene-8,15-dione.
| Compound Name | (1S,9S,10S,11R)-9-chloro-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2,4,6-triene-8,15-dione |
|---|---|
| PubChem CID | 129011514 |
| Molecular Formula | C25H29ClO2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (1S,9S,10S,11R)-9-chloro-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2,4,6-triene-8,15-dione |
| SMILES | CC(C)=CCC[C@@]1(C)[C@@H]2CC(=C(C)C)C[C@]23C(=O)[C@@]1(Cl)C(=O)c1ccccc13 |
| InChI | InChI=1S/C25H29ClO2/c1-15(2)9-8-12-23(5)20-13-17(16(3)4)14-24(20)19-11-7-6-10-18(19)21(27)25(23,26)22(24)28/h6-7,9-11,20H,8,12-14H2,1-5H3/t20-,23-,24+,25-/m0/s1 |
| InChIKey | YEGYCDJOTZCDQM-OXCBMLQPSA-N |
| XLogP | 6.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|