C21H28O3 — CID 129011732
methyl (1S,4R,5S,7R,8R)-7-hydroxy-5-(3-phenylpropyl)tricyclo[5.3.0.04,8]decane-1-carboxylate (PubChem CID 129011732) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl (1S,4R,5S,7R,8R)-7-hydroxy-5-(3-phenylpropyl)tricyclo[5.3.0.04,8]decane-1-carboxylate.
| Compound Name | methyl (1S,4R,5S,7R,8R)-7-hydroxy-5-(3-phenylpropyl)tricyclo[5.3.0.04,8]decane-1-carboxylate |
|---|---|
| PubChem CID | 129011732 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl (1S,4R,5S,7R,8R)-7-hydroxy-5-(3-phenylpropyl)tricyclo[5.3.0.04,8]decane-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H]3[C@@H](CCCc4ccccc4)C[C@@]1(O)[C@@H]3CC2 |
| InChI | InChI=1S/C21H28O3/c1-24-19(22)20-12-10-17-16(14-21(20,23)18(17)11-13-20)9-5-8-15-6-3-2-4-7-15/h2-4,6-7,16-18,23H,5,8-14H2,1H3/t16-,17+,18+,20+,21+/m0/s1 |
| InChIKey | XXQWXKHJEHVATP-QOLKULSZSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |