C15H26O3 — CID 129011745
propan-2-yl (1S,2R,3S)-1-but-3-enyl-2-hydroxy-2,3-dimethylcyclopentane-1-carboxylate (PubChem CID 129011745) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is propan-2-yl (1S,2R,3S)-1-but-3-enyl-2-hydroxy-2,3-dimethylcyclopentane-1-carboxylate.
| Compound Name | propan-2-yl (1S,2R,3S)-1-but-3-enyl-2-hydroxy-2,3-dimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 129011745 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | propan-2-yl (1S,2R,3S)-1-but-3-enyl-2-hydroxy-2,3-dimethylcyclopentane-1-carboxylate |
| SMILES | C=CCC[C@]1(C(=O)OC(C)C)CC[C@H](C)[C@@]1(C)O |
| InChI | InChI=1S/C15H26O3/c1-6-7-9-15(13(16)18-11(2)3)10-8-12(4)14(15,5)17/h6,11-12,17H,1,7-10H2,2-5H3/t12-,14+,15+/m0/s1 |
| InChIKey | NPQLMELMZYJFNZ-NWANDNLSSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|