C17H30O3 — CID 129011746
methyl (1S,2R,3S)-1-[(Z)-hex-3-enyl]-2-hydroxy-2-methyl-3-propylcyclopentane-1-carboxylate (PubChem CID 129011746) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is methyl (1S,2R,3S)-1-[(Z)-hex-3-enyl]-2-hydroxy-2-methyl-3-propylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S)-1-[(Z)-hex-3-enyl]-2-hydroxy-2-methyl-3-propylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 129011746 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | methyl (1S,2R,3S)-1-[(Z)-hex-3-enyl]-2-hydroxy-2-methyl-3-propylcyclopentane-1-carboxylate |
| SMILES | CC/C=C\CC[C@]1(C(=O)OC)CC[C@H](CCC)[C@@]1(C)O |
| InChI | InChI=1S/C17H30O3/c1-5-7-8-9-12-17(15(18)20-4)13-11-14(10-6-2)16(17,3)19/h7-8,14,19H,5-6,9-13H2,1-4H3/b8-7-/t14-,16+,17+/m0/s1 |
| InChIKey | YTVLJUXPNZPFJG-LIGYETSESA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|