C11H12O5S — CID 129012252
[(9S,11R)-11-hydroxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] hydrogen sulfate (PubChem CID 129012252) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is [(9S,11R)-11-hydroxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] hydrogen sulfate.
| Compound Name | [(9S,11R)-11-hydroxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] hydrogen sulfate |
|---|---|
| PubChem CID | 129012252 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | [(9S,11R)-11-hydroxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)O[C@H]1CC2c3ccccc3C1[C@@H]2O |
| InChI | InChI=1S/C11H12O5S/c12-11-8-5-9(16-17(13,14)15)10(11)7-4-2-1-3-6(7)8/h1-4,8-12H,5H2,(H,13,14,15)/t8?,9-,10?,11+/m0/s1 |
| InChIKey | JEOWJRHSXUQPAX-QONHTCSSSA-N |
| XLogP | 0.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|