About (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol
(9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol (PubChem CID 129012253) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol.
Analyze (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol?
The IUPAC name of (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol (CID 129012253) is (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol.
What is the SMILES notation for (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol?
The canonical SMILES for (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol is O[C@@H]1C2C[C@H](O)C1c1ccccc12.
What is the InChIKey of (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol?
The InChIKey is IJYOWIYFUHTPRX-QONHTCSSSA-N. The full InChI is InChI=1S/C11H12O2/c12-9-5-8-6-3-1-2-4-7(6)10(9)11(8)13/h1-4,8-13H,5H2/t8?,9-,10?,11+/m0/s1.
What are the key properties of (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol?
(9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol has a molecular weight of 176.22 g/mol, XLogP of 0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9S,11R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,11-diol is sourced from PubChem (CID 129012253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).