C24H27FN6O5S — CID 129012261
2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfonyl)amino]-5-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-pteridin-6-yl)-1-benzofuran-3-carboxamide (PubChem CID 129012261) has the molecular formula C24H27FN6O5S and a molecular weight of 530.58 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfonyl)amino]-5-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-pteridin-6-yl)-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfonyl)amino]-5-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-pteridin-6-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 129012261 |
| Molecular Formula | C24H27FN6O5S |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfonyl)amino]-5-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-pteridin-6-yl)-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(C3CNC4NCNC(=O)C4N3)cc12 |
| InChI | InChI=1S/C24H27FN6O5S/c1-26-23(32)19-15-8-14(16-10-27-22-20(30-16)24(33)29-11-28-22)17(31(2)37(3,34)35)9-18(15)36-21(19)12-4-6-13(25)7-5-12/h4-9,16,20,22,27-28,30H,10-11H2,1-3H3,(H,26,32)(H,29,33) |
| InChIKey | DJLLZWXYVJYVLU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |