C22H25NO3S — CID 129012317
1-(2-ethoxy-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine (PubChem CID 129012317) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-(2-ethoxy-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine.
| Compound Name | 1-(2-ethoxy-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 129012317 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-(2-ethoxy-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
| SMILES | CCOc1ccc2c(c1)C(CC(C)N(C)C)=C1c3ccccc3S(=O)(=O)C12 |
| InChI | InChI=1S/C22H25NO3S/c1-5-26-15-10-11-16-18(13-15)19(12-14(2)23(3)4)21-17-8-6-7-9-20(17)27(24,25)22(16)21/h6-11,13-14,22H,5,12H2,1-4H3 |
| InChIKey | MJDLNDHZHBWZQE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|