C20H20ClN — CID 129012325
2-(2-chloro-4b,5-dihydroindeno[2,1-a]inden-10-yl)-N,N-dimethylethanamine (PubChem CID 129012325) has the molecular formula C20H20ClN and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(2-chloro-4b,5-dihydroindeno[2,1-a]inden-10-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(2-chloro-4b,5-dihydroindeno[2,1-a]inden-10-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 129012325 |
| Molecular Formula | C20H20ClN |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-(2-chloro-4b,5-dihydroindeno[2,1-a]inden-10-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=C2c3ccccc3CC2c2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H20ClN/c1-22(2)10-9-17-18-12-14(21)7-8-16(18)19-11-13-5-3-4-6-15(13)20(17)19/h3-8,12,19H,9-11H2,1-2H3 |
| InChIKey | KFJGBLXBLVQBEX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|