C28H26FN7O2 — CID 129012399
2-[(1S)-1-[[5-[(3-fluoro-5-hydroxyphenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 129012399) has the molecular formula C28H26FN7O2 and a molecular weight of 511.56 g/mol. Its IUPAC name is 2-[(1S)-1-[[5-[(3-fluoro-5-hydroxyphenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(1S)-1-[[5-[(3-fluoro-5-hydroxyphenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 129012399 |
| Molecular Formula | C28H26FN7O2 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-[(1S)-1-[[5-[(3-fluoro-5-hydroxyphenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccn2c1C(=O)N(c1ccccc1)C([C@H](C)Nc1ncnc3[nH]cc(Cc4cc(O)cc(F)c4)c13)N2 |
| InChI | InChI=1S/C28H26FN7O2/c1-16-8-9-35-24(16)28(38)36(21-6-4-3-5-7-21)27(34-35)17(2)33-26-23-19(14-30-25(23)31-15-32-26)10-18-11-20(29)13-22(37)12-18/h3-9,11-15,17,27,34,37H,10H2,1-2H3,(H2,30,31,32,33)/t17-,27?/m0/s1 |
| InChIKey | KNNMPQUKWNPFLV-OIGLVOGNSA-N |
| XLogP | 4.53 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |