C26H25F3N8O2 — CID 129012419
2-[(1S)-1-[[6-amino-5-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 129012419) has the molecular formula C26H25F3N8O2 and a molecular weight of 538.53 g/mol. Its IUPAC name is 2-[(1S)-1-[[6-amino-5-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(1S)-1-[[6-amino-5-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 129012419 |
| Molecular Formula | C26H25F3N8O2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[(1S)-1-[[6-amino-5-[5-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenyl-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccn2c1C(=O)N(c1ccccc1)C([C@H](C)Nc1ncnc(N)c1-c1cncc(OCC(F)(F)F)c1)N2 |
| InChI | InChI=1S/C26H25F3N8O2/c1-15-8-9-36-21(15)25(38)37(18-6-4-3-5-7-18)24(35-36)16(2)34-23-20(22(30)32-14-33-23)17-10-19(12-31-11-17)39-13-26(27,28)29/h3-12,14,16,24,35H,13H2,1-2H3,(H3,30,32,33,34)/t16-,24?/m0/s1 |
| InChIKey | BHEBAZUFHRTKED-FXIRQEPWSA-N |
| XLogP | 4.20 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |