About N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide
N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide (PubChem CID 129012496) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide |
| PubChem CID | 129012496 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2C=CCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-10-6-8-11(9-7-10)18(16,17)14-12-4-2-3-5-13(12)15/h2,4,6-9,12-15H,3,5H2,1H3/t12-,13+/m1/s1 |
| InChIKey | BVLQHNHKBYHNET-OLZOCXBDSA-N |
| XLogP | 1.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide (CID 129012496) is N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N[C@@H]2C=CCC[C@@H]2O)cc1.
What is the InChIKey of N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide?
The InChIKey is BVLQHNHKBYHNET-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-10-6-8-11(9-7-10)18(16,17)14-12-4-2-3-5-13(12)15/h2,4,6-9,12-15H,3,5H2,1H3/t12-,13+/m1/s1.
What are the key properties of N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide?
N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide has a molecular weight of 267.35 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,6S)-6-hydroxycyclohex-2-en-1-yl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 129012496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).