C16H21NO3S — CID 129012497
(3aR,7aS)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-3a,6,7,7a-tetrahydro-1,3-benzoxazole (PubChem CID 129012497) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is (3aR,7aS)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-3a,6,7,7a-tetrahydro-1,3-benzoxazole.
| Compound Name | (3aR,7aS)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-3a,6,7,7a-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 129012497 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3aR,7aS)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-3a,6,7,7a-tetrahydro-1,3-benzoxazole |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3C=CCC[C@@H]3OC2(C)C)cc1 |
| InChI | InChI=1S/C16H21NO3S/c1-12-8-10-13(11-9-12)21(18,19)17-14-6-4-5-7-15(14)20-16(17,2)3/h4,6,8-11,14-15H,5,7H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | GDCXSEXLPRSTKI-CABCVRRESA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|