C19H24N6O — CID 129012610
6-[3-(cyclobutylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 129012610) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 6-[3-(cyclobutylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-[3-(cyclobutylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 129012610 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 6-[3-(cyclobutylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2cccc(C3CC4C(=O)NCNC4N3)c2nc1NC1CCC1 |
| InChI | InChI=1S/C19H24N6O/c1-10-17(23-11-4-2-5-11)25-16-12(6-3-7-14(16)22-10)15-8-13-18(24-15)20-9-21-19(13)26/h3,6-7,11,13,15,18,20,24H,2,4-5,8-9H2,1H3,(H,21,26)(H,23,25) |
| InChIKey | VFUJNQDFPCLUQQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |