C28H40O4 — CID 129012640
[(1S,4R,5S,9S,10S,12R,14R)-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylcyclohexane-1-carboxylate (PubChem CID 129012640) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is [(1S,4R,5S,9S,10S,12R,14R)-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylcyclohexane-1-carboxylate.
| Compound Name | [(1S,4R,5S,9S,10S,12R,14R)-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129012640 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | [(1S,4R,5S,9S,10S,12R,14R)-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 1-methylcyclohexane-1-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)C[C@@H]2[C@H]1OC(=O)C1(C)CCCCC1)[C@@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C28H40O4/c1-16-14-28-17(2)11-20-22(26(20,3)4)19(24(28)30)12-18(15-29)13-21(28)23(16)32-25(31)27(5)9-7-6-8-10-27/h12,14,17,19-23,29H,6-11,13,15H2,1-5H3/t17-,19+,20-,21-,22-,23+,28-/m1/s1 |
| InChIKey | AVVLTKODVZUEMR-WPHWFDNYSA-N |
| XLogP | 5.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|