About (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one
(2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one (PubChem CID 129012676) has the molecular formula C15H16N2OS2
and a molecular weight of 304.44 g/mol. Its IUPAC name is (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one |
| PubChem CID | 129012676 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(N2C(=O)[C@@H](C)S[C@H]2c2sccc2C)n1 |
| InChI | InChI=1S/C15H16N2OS2/c1-9-7-8-19-13(9)15-17(14(18)11(3)20-15)12-6-4-5-10(2)16-12/h4-8,11,15H,1-3H3/t11-,15+/m1/s1 |
| InChIKey | VJSFYZADEFODGH-ABAIWWIYSA-N |
| XLogP | 3.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one?
The IUPAC name of (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one (CID 129012676) is (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one.
What is the SMILES notation for (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one?
The canonical SMILES for (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one is Cc1cccc(N2C(=O)[C@@H](C)S[C@H]2c2sccc2C)n1.
What is the InChIKey of (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one?
The InChIKey is VJSFYZADEFODGH-ABAIWWIYSA-N. The full InChI is InChI=1S/C15H16N2OS2/c1-9-7-8-19-13(9)15-17(14(18)11(3)20-15)12-6-4-5-10(2)16-12/h4-8,11,15H,1-3H3/t11-,15+/m1/s1.
What are the key properties of (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one?
(2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one has a molecular weight of 304.44 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-5-methyl-3-(6-methyl-2-pyridinyl)-2-(3-methylthiophen-2-yl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 129012676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).