C21H18F2N2O2S — CID 129012803
5-(3-fluoro-2-methylphenyl)-2-(4-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d][1,3]thiazole-5-carboxamide (PubChem CID 129012803) has the molecular formula C21H18F2N2O2S and a molecular weight of 400.45 g/mol. Its IUPAC name is 5-(3-fluoro-2-methylphenyl)-2-(4-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d][1,3]thiazole-5-carboxamide.
| Compound Name | 5-(3-fluoro-2-methylphenyl)-2-(4-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129012803 |
| Molecular Formula | C21H18F2N2O2S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-(3-fluoro-2-methylphenyl)-2-(4-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d][1,3]thiazole-5-carboxamide |
| SMILES | Cc1cc(F)ccc1-c1nc2c(s1)CC(C(=O)NO)(c1cccc(F)c1C)C2 |
| InChI | InChI=1S/C21H18F2N2O2S/c1-11-8-13(22)6-7-14(11)19-24-17-9-21(20(26)25-27,10-18(17)28-19)15-4-3-5-16(23)12(15)2/h3-8,27H,9-10H2,1-2H3,(H,25,26) |
| InChIKey | ALQTZIMWKAXBSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|