About S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate
S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate (PubChem CID 129013069) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate.
Molecular Properties
| Compound Name | S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate |
| PubChem CID | 129013069 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H]1C[C@@H](O)CN1C(C)=O |
| InChI | InChI=1S/C9H15NO3S/c1-6(11)10-4-9(13)3-8(10)5-14-7(2)12/h8-9,13H,3-5H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | UMSMTQGWEHXVAC-DTWKUNHWSA-N |
| XLogP | 0.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate?
The IUPAC name of S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate (CID 129013069) is S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate.
What is the SMILES notation for S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate?
The canonical SMILES for S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate is CC(=O)SC[C@@H]1C[C@@H](O)CN1C(C)=O.
What is the InChIKey of S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate?
The InChIKey is UMSMTQGWEHXVAC-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H15NO3S/c1-6(11)10-4-9(13)3-8(10)5-14-7(2)12/h8-9,13H,3-5H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate?
S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate has a molecular weight of 217.29 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[(2S,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]methyl] ethanethioate is sourced from PubChem (CID 129013069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).