C28H32FN5O4 — CID 129013298
3-cyclobutyl-1-(4-fluorophenyl)-4-(3-morpholin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl)pyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 129013298) has the molecular formula C28H32FN5O4 and a molecular weight of 521.59 g/mol. Its IUPAC name is 3-cyclobutyl-1-(4-fluorophenyl)-4-(3-morpholin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl)pyrazolo[5,4-b]pyridine-6-carboxylic acid.
| Compound Name | 3-cyclobutyl-1-(4-fluorophenyl)-4-(3-morpholin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl)pyrazolo[5,4-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 129013298 |
| Molecular Formula | C28H32FN5O4 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-cyclobutyl-1-(4-fluorophenyl)-4-(3-morpholin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl)pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(N2CCC3C(C2)OCC3N2CCOCC2)c2c(C3CCC3)nn(-c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C28H32FN5O4/c29-18-4-6-19(7-5-18)34-27-25(26(31-34)17-2-1-3-17)22(14-21(30-27)28(35)36)33-9-8-20-23(16-38-24(20)15-33)32-10-12-37-13-11-32/h4-7,14,17,20,23-24H,1-3,8-13,15-16H2,(H,35,36) |
| InChIKey | RPWSFIJODAQILM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |