About methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate
methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate (PubChem CID 12901362) has the molecular formula C10H15FN2O4S
and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate |
| PubChem CID | 12901362 |
| Molecular Formula | C10H15FN2O4S |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate |
| SMILES | CCCCSC1NC(=O)NC(=O)C1(F)C(=O)OC |
| InChI | InChI=1S/C10H15FN2O4S/c1-3-4-5-18-7-10(11,8(15)17-2)6(14)12-9(16)13-7/h7H,3-5H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | STTPGIRVAZQZPE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate?
The IUPAC name of methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate (CID 12901362) is methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate.
What is the SMILES notation for methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate?
The canonical SMILES for methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate is CCCCSC1NC(=O)NC(=O)C1(F)C(=O)OC.
What is the InChIKey of methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate?
The InChIKey is STTPGIRVAZQZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O4S/c1-3-4-5-18-7-10(11,8(15)17-2)6(14)12-9(16)13-7/h7H,3-5H2,1-2H3,(H2,12,13,14,16).
What are the key properties of methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate?
methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate has a molecular weight of 278.31 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate is sourced from PubChem (CID 12901362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).