About 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile
2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile (PubChem CID 129013964) has the molecular formula C8H8INO3S
and a molecular weight of 325.13 g/mol. Its IUPAC name is 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile.
Molecular Properties
| Compound Name | 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile |
| PubChem CID | 129013964 |
| Molecular Formula | C8H8INO3S |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile |
| SMILES | N#CC12CC3CC1C(OS2(=O)=O)C3I |
| InChI | InChI=1S/C8H8INO3S/c9-6-4-1-5-7(6)13-14(11,12)8(5,2-4)3-10/h4-7H,1-2H2 |
| InChIKey | WCSDFFORLMFQKC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The IUPAC name of 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile (CID 129013964) is 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile.
What is the SMILES notation for 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The canonical SMILES for 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile is N#CC12CC3CC1C(OS2(=O)=O)C3I.
What is the InChIKey of 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
The InChIKey is WCSDFFORLMFQKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO3S/c9-6-4-1-5-7(6)13-14(11,12)8(5,2-4)3-10/h4-7H,1-2H2.
What are the key properties of 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile?
2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile has a molecular weight of 325.13 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carbonitrile is sourced from PubChem (CID 129013964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).