About 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine
5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine (PubChem CID 129014323) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine |
| PubChem CID | 129014323 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine |
| SMILES | CC(C)c1nc2cnoc2nc1C(C)C |
| InChI | InChI=1S/C11H15N3O/c1-6(2)9-10(7(3)4)14-11-8(13-9)5-12-15-11/h5-7H,1-4H3 |
| InChIKey | XHSRAKRYQYDCJH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine?
The IUPAC name of 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine (CID 129014323) is 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine.
What is the SMILES notation for 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine?
The canonical SMILES for 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine is CC(C)c1nc2cnoc2nc1C(C)C.
What is the InChIKey of 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine?
The InChIKey is XHSRAKRYQYDCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-6(2)9-10(7(3)4)14-11-8(13-9)5-12-15-11/h5-7H,1-4H3.
What are the key properties of 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine?
5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine has a molecular weight of 205.26 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(propan-2-yl)-[1,2]oxazolo[4,5-b]pyrazine is sourced from PubChem (CID 129014323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).