About 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol
1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol (PubChem CID 129014452) has the molecular formula C4H7N3S2
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol.
Molecular Properties
| Compound Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol |
| PubChem CID | 129014452 |
| Molecular Formula | C4H7N3S2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol |
| SMILES | CC(S)c1nnc(N)s1 |
| InChI | InChI=1S/C4H7N3S2/c1-2(8)3-6-7-4(5)9-3/h2,8H,1H3,(H2,5,7) |
| InChIKey | QPDJKQSRGTVTJW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol?
The IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol (CID 129014452) is 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol.
What is the SMILES notation for 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol?
The canonical SMILES for 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol is CC(S)c1nnc(N)s1.
What is the InChIKey of 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol?
The InChIKey is QPDJKQSRGTVTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S2/c1-2(8)3-6-7-4(5)9-3/h2,8H,1H3,(H2,5,7).
What are the key properties of 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol?
1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol has a molecular weight of 161.25 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,3,4-thiadiazol-2-yl)ethanethiol is sourced from PubChem (CID 129014452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).