About (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate
(2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate (PubChem CID 129014494) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 129014494 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate |
| SMILES | Cc1ncc(OC(=O)C2CCC(C)CC2)cn1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-3-5-11(6-4-9)13(16)17-12-7-14-10(2)15-8-12/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | MPLNCLPQADZVGS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate?
The IUPAC name of (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate (CID 129014494) is (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate is Cc1ncc(OC(=O)C2CCC(C)CC2)cn1.
What is the InChIKey of (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate?
The InChIKey is MPLNCLPQADZVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-9-3-5-11(6-4-9)13(16)17-12-7-14-10(2)15-8-12/h7-9,11H,3-6H2,1-2H3.
What are the key properties of (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate?
(2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate has a molecular weight of 234.30 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrimidin-5-yl) 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 129014494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).