C8H12O4S — CID 129014639
(3aS,4S,6S)-2,2-dimethyl-4-sulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde (PubChem CID 129014639) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is (3aS,4S,6S)-2,2-dimethyl-4-sulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde.
| Compound Name | (3aS,4S,6S)-2,2-dimethyl-4-sulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 129014639 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (3aS,4S,6S)-2,2-dimethyl-4-sulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
| SMILES | CC1(C)OC2[C@@H](C=O)O[C@@H](S)[C@H]2O1 |
| InChI | InChI=1S/C8H12O4S/c1-8(2)11-5-4(3-9)10-7(13)6(5)12-8/h3-7,13H,1-2H3/t4-,5?,6+,7+/m1/s1 |
| InChIKey | APNDALDSAVDNAH-FYHJMYJVSA-N |
| XLogP | 0.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|