C9H15N3O3S — CID 129014645
(3aS,4S,6R)-6-[(1R)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-thiol (PubChem CID 129014645) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is (3aS,4S,6R)-6-[(1R)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-thiol.
| Compound Name | (3aS,4S,6R)-6-[(1R)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-thiol |
|---|---|
| PubChem CID | 129014645 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (3aS,4S,6R)-6-[(1R)-1-azidoethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-thiol |
| SMILES | C[C@@H](N=[N+]=[N-])[C@H]1O[C@@H](S)[C@H]2OC(C)(C)OC21 |
| InChI | InChI=1S/C9H15N3O3S/c1-4(11-12-10)5-6-7(8(16)13-5)15-9(2,3)14-6/h4-8,16H,1-3H3/t4-,5-,6?,7+,8+/m1/s1 |
| InChIKey | XRVDRPUYWPYKPP-RDHCVBCUSA-N |
| XLogP | 1.86 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|