About 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole
1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole (PubChem CID 129015104) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole |
| PubChem CID | 129015104 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole |
| SMILES | C=C(/C=C\C)N1CCC2=C1CC=CC=C2 |
| InChI | InChI=1S/C14H17N/c1-3-7-12(2)15-11-10-13-8-5-4-6-9-14(13)15/h3-8H,2,9-11H2,1H3/b7-3- |
| InChIKey | YQEKOYHAAYOZHU-CLTKARDFSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole?
The IUPAC name of 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole (CID 129015104) is 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole.
What is the SMILES notation for 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole?
The canonical SMILES for 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole is C=C(/C=C\C)N1CCC2=C1CC=CC=C2.
What is the InChIKey of 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole?
The InChIKey is YQEKOYHAAYOZHU-CLTKARDFSA-N. The full InChI is InChI=1S/C14H17N/c1-3-7-12(2)15-11-10-13-8-5-4-6-9-14(13)15/h3-8H,2,9-11H2,1H3/b7-3-.
What are the key properties of 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole?
1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole has a molecular weight of 199.30 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-penta-1,3-dien-2-yl]-3,8-dihydro-2H-cyclohepta[b]pyrrole is sourced from PubChem (CID 129015104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).