C23H39NO9S — CID 129015262
S-[2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate (PubChem CID 129015262) has the molecular formula C23H39NO9S and a molecular weight of 505.63 g/mol. Its IUPAC name is S-[2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate.
| Compound Name | S-[2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 129015262 |
| Molecular Formula | C23H39NO9S |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | S-[2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-7-acetamido-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] ethanethioate |
| SMILES | CC(=O)N[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@]2(COCCOCCOCCOCCSC(C)=O)CC[C@H]1O2 |
| InChI | InChI=1S/C23H39NO9S/c1-16(25)24-19-18-5-6-23(31-18,21-20(19)32-22(3,4)33-21)15-30-12-11-28-8-7-27-9-10-29-13-14-34-17(2)26/h18-21H,5-15H2,1-4H3,(H,24,25)/t18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | OTSJFTVQDKPMEZ-AIDNLNPPSA-N |
| XLogP | 1.29 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|