C31H32F3NO5 — CID 129015320
N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 129015320) has the molecular formula C31H32F3NO5 and a molecular weight of 555.59 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 129015320 |
| Molecular Formula | C31H32F3NO5 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@]2(COCc3ccccc3)CC[C@H]1O2)C(F)(F)F |
| InChI | InChI=1S/C31H32F3NO5/c32-31(33,34)29(36)35-26-25-16-17-30(40-25,21-37-18-22-10-4-1-5-11-22)28(39-20-24-14-8-3-9-15-24)27(26)38-19-23-12-6-2-7-13-23/h1-15,25-28H,16-21H2,(H,35,36)/t25-,26+,27-,28-,30-/m1/s1 |
| InChIKey | SRFCYUHBWCJROD-QVNPJVKASA-N |
| XLogP | 5.35 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |