C32H34F3NO5 — CID 129015325
N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide (PubChem CID 129015325) has the molecular formula C32H34F3NO5 and a molecular weight of 569.62 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 129015325 |
| Molecular Formula | C32H34F3NO5 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-[(1R,2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]octan-2-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@]2(COCc3ccccc3)CC[C@H]1O2 |
| InChI | InChI=1S/C32H34F3NO5/c33-32(34,35)18-27(37)36-28-26-16-17-31(41-26,22-38-19-23-10-4-1-5-11-23)30(40-21-25-14-8-3-9-15-25)29(28)39-20-24-12-6-2-7-13-24/h1-15,26,28-30H,16-22H2,(H,36,37)/t26-,28+,29-,30-,31-/m1/s1 |
| InChIKey | PCEFNZBOESETDM-YJWURLRRSA-N |
| XLogP | 5.74 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |