C25H45NO12S — CID 129015358
2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 129015358) has the molecular formula C25H45NO12S and a molecular weight of 583.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 129015358 |
| Molecular Formula | C25H45NO12S |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 2-[2-[2-[2-[[(1R,2R,6R,7S,8R)-4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@]2(COCCOCCOCCOCCOS(C)(=O)=O)CC[C@H]1O2 |
| InChI | InChI=1S/C25H45NO12S/c1-23(2,3)38-22(27)26-19-18-7-8-25(35-18,21-20(19)36-24(4,5)37-21)17-33-14-13-31-10-9-30-11-12-32-15-16-34-39(6,28)29/h18-21H,7-17H2,1-6H3,(H,26,27)/t18-,19+,20-,21-,25-/m1/s1 |
| InChIKey | VAHVTJJDXHVPNX-QNFRPBLGSA-N |
| XLogP | 1.37 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|