C24H44N2O9 — CID 129015359
tert-butyl N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate (PubChem CID 129015359) has the molecular formula C24H44N2O9 and a molecular weight of 504.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate |
|---|---|
| PubChem CID | 129015359 |
| Molecular Formula | C24H44N2O9 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | tert-butyl N-[(1R,2R,6R,7S,8R)-1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-4,4-dimethyl-3,5,11-trioxatricyclo[6.2.1.02,6]undecan-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@]2(COCCOCCOCCOCCN)CC[C@H]1O2 |
| InChI | InChI=1S/C24H44N2O9/c1-22(2,3)35-21(27)26-18-17-6-7-24(32-17,20-19(18)33-23(4,5)34-20)16-31-15-14-30-13-12-29-11-10-28-9-8-25/h17-20H,6-16,25H2,1-5H3,(H,26,27)/t17-,18+,19-,20-,24-/m1/s1 |
| InChIKey | ISCYDIOWIRQGFA-YBZAYSDLSA-N |
| XLogP | 1.36 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|