C32H36N8O4S — CID 129015638
15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione (PubChem CID 129015638) has the molecular formula C32H36N8O4S and a molecular weight of 628.76 g/mol. Its IUPAC name is 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione.
| Compound Name | 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
|---|---|
| PubChem CID | 129015638 |
| Molecular Formula | C32H36N8O4S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NC(CCNCc2ccccc2)C(=O)NCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C32H36N8O4S/c41-29-25(9-13-33-18-21-5-2-1-3-6-21)36-31(43)28-26(19-40(39-28)24-10-15-44-16-11-24)37-30(42)27-20-45-32(38-27)22-8-14-34-23(17-22)7-4-12-35-29/h1-3,5-6,8,14,17,19-20,24-25,33H,4,7,9-13,15-16,18H2,(H,35,41)(H,36,43)(H,37,42) |
| InChIKey | OBTAFSFBDRUMRL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|