About 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine
2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine (PubChem CID 129015725) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine.
Analyze 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine?
The IUPAC name of 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine (CID 129015725) is 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine.
What is the SMILES notation for 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine?
The canonical SMILES for 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine is CC1=NC(C)N(C)NC1C.
What is the InChIKey of 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine?
The InChIKey is QMESTHLZISTQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-5-6(2)9-10(4)7(3)8-5/h6-7,9H,1-4H3.
What are the key properties of 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine?
2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine has a molecular weight of 141.22 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetramethyl-3,6-dihydro-1H-1,2,4-triazine is sourced from PubChem (CID 129015725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).