C27H30F6N4O3 — CID 129015763
4-[(3S,6S)-3-acetyl-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-(1-methylcyclohexa-2,4-dien-1-yl)piperidin-3-yl]-1H-1,2,4-triazol-5-one (PubChem CID 129015763) has the molecular formula C27H30F6N4O3 and a molecular weight of 572.55 g/mol. Its IUPAC name is 4-[(3S,6S)-3-acetyl-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-(1-methylcyclohexa-2,4-dien-1-yl)piperidin-3-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[(3S,6S)-3-acetyl-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-(1-methylcyclohexa-2,4-dien-1-yl)piperidin-3-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 129015763 |
| Molecular Formula | C27H30F6N4O3 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 4-[(3S,6S)-3-acetyl-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-(1-methylcyclohexa-2,4-dien-1-yl)piperidin-3-yl]-1H-1,2,4-triazol-5-one |
| SMILES | CC(=O)[C@]1(n2cn[nH]c2=O)CC[C@@](CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(C2(C)C=CC=CC2)NC1 |
| InChI | InChI=1S/C27H30F6N4O3/c1-17(19-11-20(26(28,29)30)13-21(12-19)27(31,32)33)40-15-25(23(3)7-5-4-6-8-23)10-9-24(14-34-25,18(2)38)37-16-35-36-22(37)39/h4-7,11-13,16-17,34H,8-10,14-15H2,1-3H3,(H,36,39)/t17-,23?,24+,25-/m1/s1 |
| InChIKey | KIUZBCMMNRTAQD-UVVPUUQLSA-N |
| XLogP | 5.32 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |