About 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine
4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine (PubChem CID 129015792) has the molecular formula C18H34N2O
and a molecular weight of 294.48 g/mol. Its IUPAC name is 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine |
| PubChem CID | 129015792 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine |
| SMILES | CC1(C)[C@@H](CCN2CCCCC2)C[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C18H34N2O/c1-18(2)16(6-9-19-7-4-3-5-8-19)14-17(18)15-20-10-12-21-13-11-20/h16-17H,3-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | POTJFFZWYAYFBO-IRXDYDNUSA-N |
| XLogP | 2.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine?
The IUPAC name of 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine (CID 129015792) is 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine.
What is the SMILES notation for 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine?
The canonical SMILES for 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine is CC1(C)[C@@H](CCN2CCCCC2)C[C@H]1CN1CCOCC1.
What is the InChIKey of 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine?
The InChIKey is POTJFFZWYAYFBO-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H34N2O/c1-18(2)16(6-9-19-7-4-3-5-8-19)14-17(18)15-20-10-12-21-13-11-20/h16-17H,3-15H2,1-2H3/t16-,17-/m0/s1.
What are the key properties of 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine?
4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine has a molecular weight of 294.48 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,3R)-2,2-dimethyl-3-(2-piperidin-1-ylethyl)cyclobutyl]methyl]morpholine is sourced from PubChem (CID 129015792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).