About 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine
5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine (PubChem CID 129016140) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine |
| PubChem CID | 129016140 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine |
| SMILES | C=C(C1=CNC(N)C=C1)[C@@H](N)CCSC |
| InChI | InChI=1S/C11H19N3S/c1-8(10(12)5-6-15-2)9-3-4-11(13)14-7-9/h3-4,7,10-11,14H,1,5-6,12-13H2,2H3/t10-,11?/m0/s1 |
| InChIKey | RHNVARAGAJKLSP-VUWPPUDQSA-N |
| XLogP | 0.95 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine?
The IUPAC name of 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine (CID 129016140) is 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine?
The canonical SMILES for 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine is C=C(C1=CNC(N)C=C1)[C@@H](N)CCSC.
What is the InChIKey of 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine?
The InChIKey is RHNVARAGAJKLSP-VUWPPUDQSA-N. The full InChI is InChI=1S/C11H19N3S/c1-8(10(12)5-6-15-2)9-3-4-11(13)14-7-9/h3-4,7,10-11,14H,1,5-6,12-13H2,2H3/t10-,11?/m0/s1.
What are the key properties of 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine?
5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine has a molecular weight of 225.36 g/mol, XLogP of 0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-3-amino-5-methylsulfanylpent-1-en-2-yl]-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 129016140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).