C11H10O3 — CID 129016270
(1R)-11-oxatetracyclo[7.3.0.02,5.05,8]dodec-3-ene-10,12-dione (PubChem CID 129016270) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (1R)-11-oxatetracyclo[7.3.0.02,5.05,8]dodec-3-ene-10,12-dione.
| Compound Name | (1R)-11-oxatetracyclo[7.3.0.02,5.05,8]dodec-3-ene-10,12-dione |
|---|---|
| PubChem CID | 129016270 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (1R)-11-oxatetracyclo[7.3.0.02,5.05,8]dodec-3-ene-10,12-dione |
| SMILES | O=C1OC(=O)[C@H]2C1C1CCC13C=CC23 |
| InChI | InChI=1S/C11H10O3/c12-9-7-5-1-3-11(5)4-2-6(11)8(7)10(13)14-9/h1,3,5-8H,2,4H2/t5?,6?,7-,8?,11?/m1/s1 |
| InChIKey | OWOIWMZXQDCWKQ-OVKREYHNSA-N |
| XLogP | 0.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|