About 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione
5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione (PubChem CID 12901633) has the molecular formula C9H6Cl2N2O3
and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione |
| PubChem CID | 12901633 |
| Molecular Formula | C9H6Cl2N2O3 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cc(Cl)cc(Cl)c2O)N1 |
| InChI | InChI=1S/C9H6Cl2N2O3/c10-3-1-4(7(14)5(11)2-3)6-8(15)13-9(16)12-6/h1-2,6,14H,(H2,12,13,15,16) |
| InChIKey | MPBNQNCVTWLCKM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione (CID 12901633) is 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione is O=C1NC(=O)C(c2cc(Cl)cc(Cl)c2O)N1.
What is the InChIKey of 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione?
The InChIKey is MPBNQNCVTWLCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N2O3/c10-3-1-4(7(14)5(11)2-3)6-8(15)13-9(16)12-6/h1-2,6,14H,(H2,12,13,15,16).
What are the key properties of 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione?
5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione has a molecular weight of 261.06 g/mol, XLogP of 1.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichloro-2-hydroxyphenyl)imidazolidine-2,4-dione is sourced from PubChem (CID 12901633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).