About 2-(2,4-dimethylpentan-3-ylideneamino)guanidine
2-(2,4-dimethylpentan-3-ylideneamino)guanidine (PubChem CID 129017258) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-3-ylideneamino)guanidine.
Molecular Properties
| Compound Name | 2-(2,4-dimethylpentan-3-ylideneamino)guanidine |
| PubChem CID | 129017258 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 2-(2,4-dimethylpentan-3-ylideneamino)guanidine |
| SMILES | CC(C)C(=NN=C(N)N)C(C)C |
| InChI | InChI=1S/C8H18N4/c1-5(2)7(6(3)4)11-12-8(9)10/h5-6H,1-4H3,(H4,9,10,12) |
| InChIKey | YRUFEZVTQYUQOV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylpentan-3-ylideneamino)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylpentan-3-ylideneamino)guanidine?
The IUPAC name of 2-(2,4-dimethylpentan-3-ylideneamino)guanidine (CID 129017258) is 2-(2,4-dimethylpentan-3-ylideneamino)guanidine.
What is the SMILES notation for 2-(2,4-dimethylpentan-3-ylideneamino)guanidine?
The canonical SMILES for 2-(2,4-dimethylpentan-3-ylideneamino)guanidine is CC(C)C(=NN=C(N)N)C(C)C.
What is the InChIKey of 2-(2,4-dimethylpentan-3-ylideneamino)guanidine?
The InChIKey is YRUFEZVTQYUQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-5(2)7(6(3)4)11-12-8(9)10/h5-6H,1-4H3,(H4,9,10,12).
What are the key properties of 2-(2,4-dimethylpentan-3-ylideneamino)guanidine?
2-(2,4-dimethylpentan-3-ylideneamino)guanidine has a molecular weight of 170.26 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylpentan-3-ylideneamino)guanidine is sourced from PubChem (CID 129017258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).