C15H27NO — CID 129017386
(2Z,4Z)-2-amino-4-tert-butyl-7,7-dimethyl-6-methylideneocta-2,4-dien-3-ol (PubChem CID 129017386) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-4-tert-butyl-7,7-dimethyl-6-methylideneocta-2,4-dien-3-ol.
| Compound Name | (2Z,4Z)-2-amino-4-tert-butyl-7,7-dimethyl-6-methylideneocta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 129017386 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2Z,4Z)-2-amino-4-tert-butyl-7,7-dimethyl-6-methylideneocta-2,4-dien-3-ol |
| SMILES | C=C(/C=C(C(\O)=C(/C)N)/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-10(14(3,4)5)9-12(15(6,7)8)13(17)11(2)16/h9,17H,1,16H2,2-8H3/b12-9+,13-11- |
| InChIKey | MEYYSWQNOAWPRC-NYGJOUKGSA-N |
| XLogP | 4.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|