C18H18ClN3O — CID 129017539
6-chloro-2-methoxy-3-methyl-4-[[4-(1-methylpyrazol-3-yl)phenyl]methyl]pyridine (PubChem CID 129017539) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-chloro-2-methoxy-3-methyl-4-[[4-(1-methylpyrazol-3-yl)phenyl]methyl]pyridine.
| Compound Name | 6-chloro-2-methoxy-3-methyl-4-[[4-(1-methylpyrazol-3-yl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 129017539 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 6-chloro-2-methoxy-3-methyl-4-[[4-(1-methylpyrazol-3-yl)phenyl]methyl]pyridine |
| SMILES | COc1nc(Cl)cc(Cc2ccc(-c3ccn(C)n3)cc2)c1C |
| InChI | InChI=1S/C18H18ClN3O/c1-12-15(11-17(19)20-18(12)23-3)10-13-4-6-14(7-5-13)16-8-9-22(2)21-16/h4-9,11H,10H2,1-3H3 |
| InChIKey | LXUNAKUJNFAXSJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|