About 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid
5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid (PubChem CID 129017817) has the molecular formula C25H28N6O2
and a molecular weight of 444.54 g/mol. Its IUPAC name is 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid.
Molecular Properties
| Compound Name | 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid |
| PubChem CID | 129017817 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid |
| SMILES | CC1(NC(=O)O)CC1.c1cc(-c2cncn2C2CCCC2)ccc1-c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C20H19N5.C5H9NO2/c1-2-4-17(3-1)25-13-21-12-20(25)15-7-5-14(6-8-15)16-9-10-18-19(11-16)23-24-22-18;1-5(2-3-5)6-4(7)8/h5-13,17H,1-4H2,(H,22,23,24);6H,2-3H2,1H3,(H,7,8) |
| InChIKey | KUMTVBJOBIPXIV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid?
The IUPAC name of 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid (CID 129017817) is 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid.
What is the SMILES notation for 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid?
The canonical SMILES for 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid is CC1(NC(=O)O)CC1.c1cc(-c2cncn2C2CCCC2)ccc1-c1ccc2n[nH]nc2c1.
What is the InChIKey of 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid?
The InChIKey is KUMTVBJOBIPXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5.C5H9NO2/c1-2-4-17(3-1)25-13-21-12-20(25)15-7-5-14(6-8-15)16-9-10-18-19(11-16)23-24-22-18;1-5(2-3-5)6-4(7)8/h5-13,17H,1-4H2,(H,22,23,24);6H,2-3H2,1H3,(H,7,8).
What are the key properties of 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid?
5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid has a molecular weight of 444.54 g/mol, XLogP of 5.41, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-cyclopentylimidazol-4-yl)phenyl]-2H-benzotriazole;(1-methylcyclopropyl)carbamic acid is sourced from PubChem (CID 129017817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).