C6H4F3N3O3 — CID 129018312
1-(2,3,3-trifluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 129018312) has the molecular formula C6H4F3N3O3 and a molecular weight of 223.11 g/mol. Its IUPAC name is 1-(2,3,3-trifluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2,3,3-trifluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 129018312 |
| Molecular Formula | C6H4F3N3O3 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 1-(2,3,3-trifluoroprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CC(F)=C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H4F3N3O3/c7-2(3(8)9)1-12-5(14)10-4(13)11-6(12)15/h1H2,(H2,10,11,13,14,15) |
| InChIKey | WMXHDOMFCLRBKJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |