About (2E,4Z)-5-ethenylocta-2,4-dien-2-ol
(2E,4Z)-5-ethenylocta-2,4-dien-2-ol (PubChem CID 129018508) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4Z)-5-ethenylocta-2,4-dien-2-ol.
Molecular Properties
| Compound Name | (2E,4Z)-5-ethenylocta-2,4-dien-2-ol |
| PubChem CID | 129018508 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E,4Z)-5-ethenylocta-2,4-dien-2-ol |
| SMILES | C=C/C(=C\C=C(/C)O)CCC |
| InChI | InChI=1S/C10H16O/c1-4-6-10(5-2)8-7-9(3)11/h5,7-8,11H,2,4,6H2,1,3H3/b9-7+,10-8+ |
| InChIKey | YPQKTGYUQVZDCO-FIFLTTCUSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-5-ethenylocta-2,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-5-ethenylocta-2,4-dien-2-ol?
The IUPAC name of (2E,4Z)-5-ethenylocta-2,4-dien-2-ol (CID 129018508) is (2E,4Z)-5-ethenylocta-2,4-dien-2-ol.
What is the SMILES notation for (2E,4Z)-5-ethenylocta-2,4-dien-2-ol?
The canonical SMILES for (2E,4Z)-5-ethenylocta-2,4-dien-2-ol is C=C/C(=C\C=C(/C)O)CCC.
What is the InChIKey of (2E,4Z)-5-ethenylocta-2,4-dien-2-ol?
The InChIKey is YPQKTGYUQVZDCO-FIFLTTCUSA-N. The full InChI is InChI=1S/C10H16O/c1-4-6-10(5-2)8-7-9(3)11/h5,7-8,11H,2,4,6H2,1,3H3/b9-7+,10-8+.
What are the key properties of (2E,4Z)-5-ethenylocta-2,4-dien-2-ol?
(2E,4Z)-5-ethenylocta-2,4-dien-2-ol has a molecular weight of 152.24 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-5-ethenylocta-2,4-dien-2-ol is sourced from PubChem (CID 129018508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).