About 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide
2-(3-methylpenta-1,4-dien-2-ylamino)propanamide (PubChem CID 129018521) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide.
Molecular Properties
| Compound Name | 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide |
| PubChem CID | 129018521 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide |
| SMILES | C=CC(C)C(=C)NC(C)C(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-5-6(2)7(3)11-8(4)9(10)12/h5-6,8,11H,1,3H2,2,4H3,(H2,10,12) |
| InChIKey | DSLJWZSAIOAFGU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide?
The IUPAC name of 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide (CID 129018521) is 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide.
What is the SMILES notation for 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide?
The canonical SMILES for 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide is C=CC(C)C(=C)NC(C)C(N)=O.
What is the InChIKey of 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide?
The InChIKey is DSLJWZSAIOAFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-5-6(2)7(3)11-8(4)9(10)12/h5-6,8,11H,1,3H2,2,4H3,(H2,10,12).
What are the key properties of 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide?
2-(3-methylpenta-1,4-dien-2-ylamino)propanamide has a molecular weight of 168.24 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylpenta-1,4-dien-2-ylamino)propanamide is sourced from PubChem (CID 129018521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).