About (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine
(Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine (PubChem CID 129018704) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine.
Molecular Properties
| Compound Name | (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine |
| PubChem CID | 129018704 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine |
| SMILES | CCO/N=C\C1C2CNCC12c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-4-19-18-9-15-14-8-17-10-16(14,15)13-6-5-11(2)12(3)7-13/h5-7,9,14-15,17H,4,8,10H2,1-3H3/b18-9- |
| InChIKey | YYLARHSEHAQYKH-NVMNQCDNSA-N |
| XLogP | 2.41 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine?
The IUPAC name of (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine (CID 129018704) is (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine.
What is the SMILES notation for (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine?
The canonical SMILES for (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine is CCO/N=C\C1C2CNCC12c1ccc(C)c(C)c1.
What is the InChIKey of (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine?
The InChIKey is YYLARHSEHAQYKH-NVMNQCDNSA-N. The full InChI is InChI=1S/C16H22N2O/c1-4-19-18-9-15-14-8-17-10-16(14,15)13-6-5-11(2)12(3)7-13/h5-7,9,14-15,17H,4,8,10H2,1-3H3/b18-9-.
What are the key properties of (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine?
(Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine has a molecular weight of 258.36 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[1-(3,4-dimethylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-ethoxymethanimine is sourced from PubChem (CID 129018704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).