C16H24N6S — CID 129018726
5-N-(3,5-dimethylphenyl)-3-N-(1-methylsulfanylpiperidin-4-yl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 129018726) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 5-N-(3,5-dimethylphenyl)-3-N-(1-methylsulfanylpiperidin-4-yl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N-(3,5-dimethylphenyl)-3-N-(1-methylsulfanylpiperidin-4-yl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 129018726 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-N-(3,5-dimethylphenyl)-3-N-(1-methylsulfanylpiperidin-4-yl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CSN1CCC(Nc2n[nH]c(Nc3cc(C)cc(C)c3)n2)CC1 |
| InChI | InChI=1S/C16H24N6S/c1-11-8-12(2)10-14(9-11)18-16-19-15(20-21-16)17-13-4-6-22(23-3)7-5-13/h8-10,13H,4-7H2,1-3H3,(H3,17,18,19,20,21) |
| InChIKey | OQVKXBIUGKOKMU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|